C15H8Cl6O4 — CID 2795220
(6-acetyloxy-1,8,9,10,11,11-hexachloro-3-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl) acetate (PubChem CID 2795220) has the molecular formula C15H8Cl6O4 and a molecular weight of 464.94 g/mol. Its IUPAC name is (6-acetyloxy-1,8,9,10,11,11-hexachloro-3-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl) acetate.
| Compound Name | (6-acetyloxy-1,8,9,10,11,11-hexachloro-3-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl) acetate |
|---|---|
| PubChem CID | 2795220 |
| Molecular Formula | C15H8Cl6O4 |
| Molecular Weight | 464.94 g/mol |
| Exact Mass | 461.86 |
| IUPAC Name | (6-acetyloxy-1,8,9,10,11,11-hexachloro-3-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl) acetate |
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c2c1C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C15H8Cl6O4/c1-5(22)24-7-3-4-8(25-6(2)23)10-9(7)13(18)11(16)12(17)14(10,19)15(13,20)21/h3-4H,1-2H3 |
| InChIKey | WXXSGKCXJWWKBM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|