C20H20O6 — CID 11810420
(4,9-diacetyloxy-5,6,7,8-tetrahydrophenanthren-1-yl) acetate (PubChem CID 11810420) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is (4,9-diacetyloxy-5,6,7,8-tetrahydrophenanthren-1-yl) acetate.
| Compound Name | (4,9-diacetyloxy-5,6,7,8-tetrahydrophenanthren-1-yl) acetate |
|---|---|
| PubChem CID | 11810420 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (4,9-diacetyloxy-5,6,7,8-tetrahydrophenanthren-1-yl) acetate |
| SMILES | CC(=O)Oc1cc2c(OC(C)=O)ccc(OC(C)=O)c2c2c1CCCC2 |
| InChI | InChI=1S/C20H20O6/c1-11(21)24-17-8-9-18(25-12(2)22)20-15-7-5-4-6-14(15)19(10-16(17)20)26-13(3)23/h8-10H,4-7H2,1-3H3 |
| InChIKey | NAHVGIACJBNBIO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|