C21H26O3 — CID 6954976
[(8S,9R,13S,14S)-4,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 6954976) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is [(8S,9R,13S,14S)-4,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(8S,9R,13S,14S)-4,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 6954976 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [(8S,9R,13S,14S)-4,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | CC(=O)Oc1ccc(C)c2c1[C@@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@H]1CC2 |
| InChI | InChI=1S/C21H26O3/c1-12-4-8-18(24-13(2)22)20-14(12)5-6-15-16(20)10-11-21(3)17(15)7-9-19(21)23/h4,8,15-17H,5-7,9-11H2,1-3H3/t15-,16+,17-,21-/m0/s1 |
| InChIKey | RNKRHMVSDHMQGT-DLRJPAPCSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|