C19H23ClO — CID 154246822
(8R,9S,13S,14S)-2-chloro-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 154246822) has the molecular formula C19H23ClO and a molecular weight of 302.84 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-chloro-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-chloro-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 154246822 |
| Molecular Formula | C19H23ClO |
| Molecular Weight | 302.84 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (8R,9S,13S,14S)-2-chloro-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | Cc1cc(Cl)cc2c1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H23ClO/c1-11-9-12(20)10-16-13(11)3-4-15-14(16)7-8-19(2)17(15)5-6-18(19)21/h9-10,14-15,17H,3-8H2,1-2H3/t14-,15+,17-,19-/m0/s1 |
| InChIKey | DQGFUXJNKQVBGK-HIRMHNASSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.84 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |