C20H25ORh2- — CID 59985754
bis(rhodium);(13S)-2,3,13-trimethyl-4,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-id-17-one (PubChem CID 59985754) has the molecular formula C20H25ORh2- and a molecular weight of 487.23 g/mol. Its IUPAC name is bis(rhodium);(13S)-2,3,13-trimethyl-4,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-id-17-one.
| Compound Name | bis(rhodium);(13S)-2,3,13-trimethyl-4,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-id-17-one |
|---|---|
| PubChem CID | 59985754 |
| Molecular Formula | C20H25ORh2- |
| Molecular Weight | 487.23 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | bis(rhodium);(13S)-2,3,13-trimethyl-4,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-4-id-17-one |
| SMILES | Cc1[c-]c2c(cc1C)C1CC[C@]3(C)C(=O)CCC3C1CC2.[Rh].[Rh] |
| InChI | InChI=1S/C20H25O.2Rh/c1-12-10-14-4-5-16-15(17(14)11-13(12)2)8-9-20(3)18(16)6-7-19(20)21;;/h11,15-16,18H,4-9H2,1-3H3;;/q-1;;/t15?,16?,18?,20-;;/m0../s1 |
| InChIKey | ABDOVTVJFRMUTM-JFZUNIEGSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|