C29H35NO6S — CID 16662580
[(8R,9S,13S,14S,17S)-17-acetyloxy-8-ethyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-sulfamoylbenzoate (PubChem CID 16662580) has the molecular formula C29H35NO6S and a molecular weight of 525.67 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-17-acetyloxy-8-ethyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-sulfamoylbenzoate.
| Compound Name | [(8R,9S,13S,14S,17S)-17-acetyloxy-8-ethyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16662580 |
| Molecular Formula | C29H35NO6S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-17-acetyloxy-8-ethyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-sulfamoylbenzoate |
| SMILES | CC[C@@]12CCc3cc(OC(=O)c4ccc(S(N)(=O)=O)cc4)ccc3[C@H]1CC[C@]1(C)[C@@H](OC(C)=O)CC[C@H]12 |
| InChI | InChI=1S/C29H35NO6S/c1-4-29-16-13-20-17-21(36-27(32)19-5-8-22(9-6-19)37(30,33)34)7-10-23(20)24(29)14-15-28(3)25(29)11-12-26(28)35-18(2)31/h5-10,17,24-26H,4,11-16H2,1-3H3,(H2,30,33,34)/t24-,25-,26+,28+,29-/m1/s1 |
| InChIKey | GINTUSYKJYNGFE-WXJBELMVSA-N |
| XLogP | 5.12 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|