C32H41NO6S — CID 16662434
[(8R,9S,13S,14S,17S)-8-ethyl-13-methyl-17-pentanoyloxy-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-sulfamoylbenzoate (PubChem CID 16662434) has the molecular formula C32H41NO6S and a molecular weight of 567.75 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-8-ethyl-13-methyl-17-pentanoyloxy-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-sulfamoylbenzoate.
| Compound Name | [(8R,9S,13S,14S,17S)-8-ethyl-13-methyl-17-pentanoyloxy-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16662434 |
| Molecular Formula | C32H41NO6S |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-8-ethyl-13-methyl-17-pentanoyloxy-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-sulfamoylbenzoate |
| SMILES | CCCCC(=O)O[C@H]1CC[C@@H]2[C@]1(C)CC[C@@H]1c3ccc(OC(=O)c4ccc(S(N)(=O)=O)cc4)cc3CC[C@]12CC |
| InChI | InChI=1S/C32H41NO6S/c1-4-6-7-29(34)39-28-15-14-27-31(28,3)18-17-26-25-13-10-23(20-22(25)16-19-32(26,27)5-2)38-30(35)21-8-11-24(12-9-21)40(33,36)37/h8-13,20,26-28H,4-7,14-19H2,1-3H3,(H2,33,36,37)/t26-,27-,28+,31+,32-/m1/s1 |
| InChIKey | PCKVDWDJPPUVRE-WNIGYGQLSA-N |
| XLogP | 6.29 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|