C30H38N2O6S — CID 130368819
[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 5-[(4-sulfamoylbenzoyl)amino]pentanoate (PubChem CID 130368819) has the molecular formula C30H38N2O6S and a molecular weight of 554.71 g/mol. Its IUPAC name is [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 5-[(4-sulfamoylbenzoyl)amino]pentanoate.
| Compound Name | [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 5-[(4-sulfamoylbenzoyl)amino]pentanoate |
|---|---|
| PubChem CID | 130368819 |
| Molecular Formula | C30H38N2O6S |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 5-[(4-sulfamoylbenzoyl)amino]pentanoate |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CC[C@@H]2OC(=O)CCCCNC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C30H38N2O6S/c1-30-16-15-24-23-12-8-21(33)18-20(23)7-11-25(24)26(30)13-14-27(30)38-28(34)4-2-3-17-32-29(35)19-5-9-22(10-6-19)39(31,36)37/h5-6,8-10,12,18,24-27,33H,2-4,7,11,13-17H2,1H3,(H,32,35)(H2,31,36,37)/t24?,25?,26?,27-,30-/m0/s1 |
| InChIKey | FZJIPIAPYHSZPK-ILNBBPDDSA-N |
| XLogP | 4.41 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|