C30H37FO3 — CID 51709129
[(8S,9S,13S,14S,17R)-3-[(4-fluorophenyl)methoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate (PubChem CID 51709129) has the molecular formula C30H37FO3 and a molecular weight of 464.62 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17R)-3-[(4-fluorophenyl)methoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate.
| Compound Name | [(8S,9S,13S,14S,17R)-3-[(4-fluorophenyl)methoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
|---|---|
| PubChem CID | 51709129 |
| Molecular Formula | C30H37FO3 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [(8S,9S,13S,14S,17R)-3-[(4-fluorophenyl)methoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@@H]1CC[C@H]2[C@H]3CCc4cc(OCc5ccc(F)cc5)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H37FO3/c1-3-4-5-29(32)34-28-15-14-27-26-12-8-21-18-23(33-19-20-6-9-22(31)10-7-20)11-13-24(21)25(26)16-17-30(27,28)2/h6-7,9-11,13,18,25-28H,3-5,8,12,14-17,19H2,1-2H3/t25-,26+,27+,28-,30+/m1/s1 |
| InChIKey | IYDDXZIYBLCCFG-AHHNXVMKSA-N |
| XLogP | 7.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |