C23H30O5 — CID 3829277
(3-acetyloxy-11-hydroxy-11,13-dimethyl-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl) acetate (PubChem CID 3829277) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (3-acetyloxy-11-hydroxy-11,13-dimethyl-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl) acetate.
| Compound Name | (3-acetyloxy-11-hydroxy-11,13-dimethyl-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl) acetate |
|---|---|
| PubChem CID | 3829277 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (3-acetyloxy-11-hydroxy-11,13-dimethyl-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CCC1C2C(C)(O)CC2(C)C(OC(C)=O)CCC12 |
| InChI | InChI=1S/C23H30O5/c1-13(24)27-16-6-8-17-15(11-16)5-7-18-19-9-10-20(28-14(2)25)22(19,3)12-23(4,26)21(17)18/h6,8,11,18-21,26H,5,7,9-10,12H2,1-4H3 |
| InChIKey | MRAJWLXFXCCZEB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|