C35H53NO6 — CID 22845948
[(8S,9S,11S,13S,14S)-3-acetyloxy-11-[11-[methoxy(methyl)amino]-11-oxoundecyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 22845948) has the molecular formula C35H53NO6 and a molecular weight of 583.81 g/mol. Its IUPAC name is [(8S,9S,11S,13S,14S)-3-acetyloxy-11-[11-[methoxy(methyl)amino]-11-oxoundecyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9S,11S,13S,14S)-3-acetyloxy-11-[11-[methoxy(methyl)amino]-11-oxoundecyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 22845948 |
| Molecular Formula | C35H53NO6 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.39 |
| IUPAC Name | [(8S,9S,11S,13S,14S)-3-acetyloxy-11-[11-[methoxy(methyl)amino]-11-oxoundecyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CON(C)C(=O)CCCCCCCCCC[C@H]1C[C@]2(C)C(OC(C)=O)CC[C@H]2[C@@H]2CCc3cc(OC(C)=O)ccc3[C@@H]12 |
| InChI | InChI=1S/C35H53NO6/c1-24(37)41-28-17-19-29-26(22-28)16-18-30-31-20-21-32(42-25(2)38)35(31,3)23-27(34(29)30)14-12-10-8-6-7-9-11-13-15-33(39)36(4)40-5/h17,19,22,27,30-32,34H,6-16,18,20-21,23H2,1-5H3/t27-,30-,31-,32?,34+,35-/m0/s1 |
| InChIKey | NQPGONSHNDRBBV-BNUKKVCPSA-N |
| XLogP | 7.55 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|