C22H28O3 — CID 69104931
[(8S,9S,13S,14S,17S)-8-ethenyl-3-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 69104931) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17S)-8-ethenyl-3-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9S,13S,14S,17S)-8-ethenyl-3-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 69104931 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [(8S,9S,13S,14S,17S)-8-ethenyl-3-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=C[C@@]12CCc3cc(O)ccc3[C@H]1CC[C@]1(C)[C@@H](OC(C)=O)CC[C@H]12 |
| InChI | InChI=1S/C22H28O3/c1-4-22-12-9-15-13-16(24)5-6-17(15)18(22)10-11-21(3)19(22)7-8-20(21)25-14(2)23/h4-6,13,18-20,24H,1,7-12H2,2-3H3/t18-,19-,20+,21+,22-/m1/s1 |
| InChIKey | RVOGAZACODQXJY-LXHROKJGSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|