C18H21NO2 — CID 23267703
[(5aS,6S,8aR)-5a-methyl-4,5,6,7,8,8a-hexahydro-1H-indeno[5,4-e]indol-6-yl] acetate (PubChem CID 23267703) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is [(5aS,6S,8aR)-5a-methyl-4,5,6,7,8,8a-hexahydro-1H-indeno[5,4-e]indol-6-yl] acetate.
| Compound Name | [(5aS,6S,8aR)-5a-methyl-4,5,6,7,8,8a-hexahydro-1H-indeno[5,4-e]indol-6-yl] acetate |
|---|---|
| PubChem CID | 23267703 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | [(5aS,6S,8aR)-5a-methyl-4,5,6,7,8,8a-hexahydro-1H-indeno[5,4-e]indol-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@H]2c3ccc4[nH]ccc4c3CC[C@]12C |
| InChI | InChI=1S/C18H21NO2/c1-11(20)21-17-6-4-15-13-3-5-16-14(8-10-19-16)12(13)7-9-18(15,17)2/h3,5,8,10,15,17,19H,4,6-7,9H2,1-2H3/t15-,17+,18+/m1/s1 |
| InChIKey | WCIFNGQPPXDYMH-NJAFHUGGSA-N |
| XLogP | 3.93 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |