C23H30O3 — CID 11792463
[(3S,13R,14R,17R)-13-methyl-17-[(2S)-1-oxopropan-2-yl]-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 11792463) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is [(3S,13R,14R,17R)-13-methyl-17-[(2S)-1-oxopropan-2-yl]-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,13R,14R,17R)-13-methyl-17-[(2S)-1-oxopropan-2-yl]-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11792463 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [(3S,13R,14R,17R)-13-methyl-17-[(2S)-1-oxopropan-2-yl]-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCc2c(ccc3c2CC[C@]2(C)[C@@H]([C@H](C)C=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H30O3/c1-14(13-24)21-8-9-22-20-6-4-16-12-17(26-15(2)25)5-7-18(16)19(20)10-11-23(21,22)3/h4,6,13-14,17,21-22H,5,7-12H2,1-3H3/t14-,17+,21-,22+,23-/m1/s1 |
| InChIKey | QEEIWRIKSKZSBK-KNGGYYDDSA-N |
| XLogP | 4.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|