C29H42O2 — CID 45044456
[17-[(2R,5S)-5,6-dimethylheptan-2-yl]-13-methyl-1,2,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 45044456) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is [17-[(2R,5S)-5,6-dimethylheptan-2-yl]-13-methyl-1,2,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-[(2R,5S)-5,6-dimethylheptan-2-yl]-13-methyl-1,2,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 45044456 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | [17-[(2R,5S)-5,6-dimethylheptan-2-yl]-13-methyl-1,2,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1=Cc2ccc3c(c2CC1)CCC1(C)C3CCC1[C@H](C)CC[C@H](C)C(C)C |
| InChI | InChI=1S/C29H42O2/c1-18(2)19(3)7-8-20(4)27-13-14-28-26-11-9-22-17-23(31-21(5)30)10-12-24(22)25(26)15-16-29(27,28)6/h9,11,17-20,27-28H,7-8,10,12-16H2,1-6H3/t19-,20+,27?,28?,29?/m0/s1 |
| InChIKey | FUUPHHVMOSNLTD-ISBIIYMCSA-N |
| XLogP | 7.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |