C28H42O — CID 98171680
(13S,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-3-methoxy-13-methyl-1,2,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene (PubChem CID 98171680) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is (13S,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-3-methoxy-13-methyl-1,2,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene.
| Compound Name | (13S,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-3-methoxy-13-methyl-1,2,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 98171680 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | (13S,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-3-methoxy-13-methyl-1,2,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene |
| SMILES | COC1=Cc2ccc3c(c2CC1)CC[C@]1(C)[C@@H]3CC[C@@H]1[C@H](C)CC[C@H](C)C(C)C |
| InChI | InChI=1S/C28H42O/c1-18(2)19(3)7-8-20(4)26-13-14-27-25-11-9-21-17-22(29-6)10-12-23(21)24(25)15-16-28(26,27)5/h9,11,17-20,26-27H,7-8,10,12-16H2,1-6H3/t19-,20+,26+,27+,28-/m0/s1 |
| InChIKey | HGMNCWQJFNALQH-FXYMSTDBSA-N |
| XLogP | 7.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |