C28H40O — CID 20847595
(10S,13R,14R,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-one (PubChem CID 20847595) has the molecular formula C28H40O and a molecular weight of 392.63 g/mol. Its IUPAC name is (10S,13R,14R,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,13R,14R,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 20847595 |
| Molecular Formula | C28H40O |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (10S,13R,14R,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)[C@@H](C)CC[C@@H](C)[C@H]1CC[C@H]2C3=C(CC[C@]12C)[C@@]1(C)C=CC(=O)C=C1C=C3 |
| InChI | InChI=1S/C28H40O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9-10,13,15,17-20,24-25H,7-8,11-12,14,16H2,1-6H3/t19-,20+,24+,25-,27-,28+/m0/s1 |
| InChIKey | ICJGXFOUVNOUFC-YWZDQHIKSA-N |
| XLogP | 7.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |