C28H44 — CID 98516235
(3R,3aS,11bS)-3-[(2S,5R)-5,6-dimethylheptan-2-yl]-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracene (PubChem CID 98516235) has the molecular formula C28H44 and a molecular weight of 380.66 g/mol. Its IUPAC name is (3R,3aS,11bS)-3-[(2S,5R)-5,6-dimethylheptan-2-yl]-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracene.
| Compound Name | (3R,3aS,11bS)-3-[(2S,5R)-5,6-dimethylheptan-2-yl]-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracene |
|---|---|
| PubChem CID | 98516235 |
| Molecular Formula | C28H44 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | (3R,3aS,11bS)-3-[(2S,5R)-5,6-dimethylheptan-2-yl]-3a,6-dimethyl-1,2,3,4,5,7,8,9,10,11b-decahydrocyclopenta[a]anthracene |
| SMILES | Cc1c2c(cc3c1CC[C@]1(C)[C@@H]3CC[C@@H]1[C@@H](C)CC[C@@H](C)C(C)C)CCCC2 |
| InChI | InChI=1S/C28H44/c1-18(2)19(3)11-12-20(4)26-13-14-27-25-17-22-9-7-8-10-23(22)21(5)24(25)15-16-28(26,27)6/h17-20,26-27H,7-16H2,1-6H3/t19-,20+,26-,27-,28+/m1/s1 |
| InChIKey | VYNNDVGUBCCCGT-ZFOYNVMHSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |