C38H58O3 — CID 6612704
[5-(5,6-dimethylhept-3-en-2-yl)-17-hexanoyl-6,10-dimethyl-13-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl] acetate (PubChem CID 6612704) has the molecular formula C38H58O3 and a molecular weight of 562.88 g/mol. Its IUPAC name is [5-(5,6-dimethylhept-3-en-2-yl)-17-hexanoyl-6,10-dimethyl-13-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl] acetate.
| Compound Name | [5-(5,6-dimethylhept-3-en-2-yl)-17-hexanoyl-6,10-dimethyl-13-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl] acetate |
|---|---|
| PubChem CID | 6612704 |
| Molecular Formula | C38H58O3 |
| Molecular Weight | 562.88 g/mol |
| Exact Mass | 562.44 |
| IUPAC Name | [5-(5,6-dimethylhept-3-en-2-yl)-17-hexanoyl-6,10-dimethyl-13-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl] acetate |
| SMILES | CCCCCC(=O)c1cc2ccc1C1CCC(C(C)C=CC(C)C(C)C)C1(C)CCC=C(C)CCC(OC(C)=O)C2 |
| InChI | InChI=1S/C38H58O3/c1-9-10-11-14-37(40)34-25-31-18-20-33(34)36-22-21-35(29(6)17-16-28(5)26(2)3)38(36,8)23-12-13-27(4)15-19-32(24-31)41-30(7)39/h13,16-18,20,25-26,28-29,32,35-36H,9-12,14-15,19,21-24H2,1-8H3 |
| InChIKey | ZHRVULQZEASYEW-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.88 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|