C18H18O2 — CID 57376665
(13R,14R)-3-methoxy-11,12,13,14,15,17-hexahydrocyclopenta[a]phenanthren-16-one (PubChem CID 57376665) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (13R,14R)-3-methoxy-11,12,13,14,15,17-hexahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (13R,14R)-3-methoxy-11,12,13,14,15,17-hexahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 57376665 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (13R,14R)-3-methoxy-11,12,13,14,15,17-hexahydrocyclopenta[a]phenanthren-16-one |
| SMILES | COc1ccc2c3c(ccc2c1)[C@@H]1CC(=O)C[C@H]1CC3 |
| InChI | InChI=1S/C18H18O2/c1-20-14-4-7-15-12(9-14)3-6-17-16(15)5-2-11-8-13(19)10-18(11)17/h3-4,6-7,9,11,18H,2,5,8,10H2,1H3/t11-,18-/m1/s1 |
| InChIKey | HBBSTQBIUPTJSZ-ADLMAVQZSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |