C19H16O2 — CID 10084827
3-methoxy-11-methyl-15,16-dihydrocyclopenta[a]phenanthren-17-one (PubChem CID 10084827) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-methoxy-11-methyl-15,16-dihydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 3-methoxy-11-methyl-15,16-dihydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 10084827 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-methoxy-11-methyl-15,16-dihydrocyclopenta[a]phenanthren-17-one |
| SMILES | COc1ccc2c(ccc3c4c(cc(C)c32)C(=O)CC4)c1 |
| InChI | InChI=1S/C19H16O2/c1-11-9-17-15(7-8-18(17)20)16-5-3-12-10-13(21-2)4-6-14(12)19(11)16/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | VKYPMKIYIGPJQT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|