C14H15O2P — CID 12500022
7-methoxy-3-methyl-1,2-dihydrobenzo[e]phosphindole 3-oxide (PubChem CID 12500022) has the molecular formula C14H15O2P and a molecular weight of 246.25 g/mol. Its IUPAC name is 7-methoxy-3-methyl-1,2-dihydrobenzo[e]phosphindole 3-oxide.
| Compound Name | 7-methoxy-3-methyl-1,2-dihydrobenzo[e]phosphindole 3-oxide |
|---|---|
| PubChem CID | 12500022 |
| Molecular Formula | C14H15O2P |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 7-methoxy-3-methyl-1,2-dihydrobenzo[e]phosphindole 3-oxide |
| SMILES | COc1ccc2c3c(ccc2c1)P(C)(=O)CC3 |
| InChI | InChI=1S/C14H15O2P/c1-16-11-4-5-12-10(9-11)3-6-14-13(12)7-8-17(14,2)15/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | UGTHFOLIQZAGAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|