C17H16O3 — CID 79638807
3-(6-methoxynaphthalene-2-carbonyl)cyclopentan-1-one (PubChem CID 79638807) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-(6-methoxynaphthalene-2-carbonyl)cyclopentan-1-one.
| Compound Name | 3-(6-methoxynaphthalene-2-carbonyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 79638807 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(6-methoxynaphthalene-2-carbonyl)cyclopentan-1-one |
| SMILES | COc1ccc2cc(C(=O)C3CCC(=O)C3)ccc2c1 |
| InChI | InChI=1S/C17H16O3/c1-20-16-7-5-11-8-13(3-2-12(11)10-16)17(19)14-4-6-15(18)9-14/h2-3,5,7-8,10,14H,4,6,9H2,1H3 |
| InChIKey | QKDHHAPXZKSBTJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |