C19H22FNO2 — CID 121479372
[1-(2-fluoroethyl)piperidin-3-yl]-(6-methoxynaphthalen-2-yl)methanone (PubChem CID 121479372) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is [1-(2-fluoroethyl)piperidin-3-yl]-(6-methoxynaphthalen-2-yl)methanone.
| Compound Name | [1-(2-fluoroethyl)piperidin-3-yl]-(6-methoxynaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 121479372 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | [1-(2-fluoroethyl)piperidin-3-yl]-(6-methoxynaphthalen-2-yl)methanone |
| SMILES | COc1ccc2cc(C(=O)C3CCCN(CCF)C3)ccc2c1 |
| InChI | InChI=1S/C19H22FNO2/c1-23-18-7-6-14-11-16(5-4-15(14)12-18)19(22)17-3-2-9-21(13-17)10-8-20/h4-7,11-12,17H,2-3,8-10,13H2,1H3 |
| InChIKey | PYVFIXHCCIXHMT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |