C26H37NO2 — CID 177314037
cyclohexane;(6-methoxynaphthalen-2-yl)-piperidin-3-ylmethanone;prop-1-ene (PubChem CID 177314037) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is cyclohexane;(6-methoxynaphthalen-2-yl)-piperidin-3-ylmethanone;prop-1-ene.
| Compound Name | cyclohexane;(6-methoxynaphthalen-2-yl)-piperidin-3-ylmethanone;prop-1-ene |
|---|---|
| PubChem CID | 177314037 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | cyclohexane;(6-methoxynaphthalen-2-yl)-piperidin-3-ylmethanone;prop-1-ene |
| SMILES | C1CCCCC1.C=CC.COc1ccc2cc(C(=O)C3CCCNC3)ccc2c1 |
| InChI | InChI=1S/C17H19NO2.C6H12.C3H6/c1-20-16-7-6-12-9-14(5-4-13(12)10-16)17(19)15-3-2-8-18-11-15;1-2-4-6-5-3-1;1-3-2/h4-7,9-10,15,18H,2-3,8,11H2,1H3;1-6H2;3H,1H2,2H3 |
| InChIKey | ACTAQSMHQHKXFC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|