C29H35N3O3 — CID 177314069
N-cyclohexylpyridine-3-carboxamide;(6-methoxynaphthalen-2-yl)-piperidin-3-ylmethanone (PubChem CID 177314069) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-cyclohexylpyridine-3-carboxamide;(6-methoxynaphthalen-2-yl)-piperidin-3-ylmethanone.
| Compound Name | N-cyclohexylpyridine-3-carboxamide;(6-methoxynaphthalen-2-yl)-piperidin-3-ylmethanone |
|---|---|
| PubChem CID | 177314069 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | N-cyclohexylpyridine-3-carboxamide;(6-methoxynaphthalen-2-yl)-piperidin-3-ylmethanone |
| SMILES | COc1ccc2cc(C(=O)C3CCCNC3)ccc2c1.O=C(NC1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C17H19NO2.C12H16N2O/c1-20-16-7-6-12-9-14(5-4-13(12)10-16)17(19)15-3-2-8-18-11-15;15-12(10-5-4-8-13-9-10)14-11-6-2-1-3-7-11/h4-7,9-10,15,18H,2-3,8,11H2,1H3;4-5,8-9,11H,1-3,6-7H2,(H,14,15) |
| InChIKey | HATDDVIHRMYMBX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |