C11H16Cl2N2O — CID 73012650
piperidin-3-yl(pyridin-3-yl)methanone;dihydrochloride (PubChem CID 73012650) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is piperidin-3-yl(pyridin-3-yl)methanone;dihydrochloride.
| Compound Name | piperidin-3-yl(pyridin-3-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 73012650 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | piperidin-3-yl(pyridin-3-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1cccnc1)C1CCCNC1 |
| InChI | InChI=1S/C11H14N2O.2ClH/c14-11(9-3-1-5-12-7-9)10-4-2-6-13-8-10;;/h1,3,5,7,10,13H,2,4,6,8H2;2*1H |
| InChIKey | JLMGPDAQJNHIAN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |