C16H24N2O3 — CID 175290521
tert-butyl formate;piperidin-3-yl(pyridin-3-yl)methanone (PubChem CID 175290521) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl formate;piperidin-3-yl(pyridin-3-yl)methanone.
| Compound Name | tert-butyl formate;piperidin-3-yl(pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 175290521 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | tert-butyl formate;piperidin-3-yl(pyridin-3-yl)methanone |
| SMILES | CC(C)(C)OC=O.O=C(c1cccnc1)C1CCCNC1 |
| InChI | InChI=1S/C11H14N2O.C5H10O2/c14-11(9-3-1-5-12-7-9)10-4-2-6-13-8-10;1-5(2,3)7-4-6/h1,3,5,7,10,13H,2,4,6,8H2;4H,1-3H3 |
| InChIKey | LTLVEBBOTLNTJX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|