C17H16F3NO2 — CID 177314079
piperidin-3-yl-[6-(trifluoromethoxy)naphthalen-2-yl]methanone (PubChem CID 177314079) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is piperidin-3-yl-[6-(trifluoromethoxy)naphthalen-2-yl]methanone.
| Compound Name | piperidin-3-yl-[6-(trifluoromethoxy)naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 177314079 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | piperidin-3-yl-[6-(trifluoromethoxy)naphthalen-2-yl]methanone |
| SMILES | O=C(c1ccc2cc(OC(F)(F)F)ccc2c1)C1CCCNC1 |
| InChI | InChI=1S/C17H16F3NO2/c18-17(19,20)23-15-6-5-11-8-13(4-3-12(11)9-15)16(22)14-2-1-7-21-10-14/h3-6,8-9,14,21H,1-2,7,10H2 |
| InChIKey | JWUMULPEGIVPSP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |