C12H13BrFNO — CID 79736726
(3-bromo-4-fluorophenyl)-piperidin-3-ylmethanone (PubChem CID 79736726) has the molecular formula C12H13BrFNO and a molecular weight of 286.14 g/mol. Its IUPAC name is (3-bromo-4-fluorophenyl)-piperidin-3-ylmethanone.
| Compound Name | (3-bromo-4-fluorophenyl)-piperidin-3-ylmethanone |
|---|---|
| PubChem CID | 79736726 |
| Molecular Formula | C12H13BrFNO |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | (3-bromo-4-fluorophenyl)-piperidin-3-ylmethanone |
| SMILES | O=C(c1ccc(F)c(Br)c1)C1CCCNC1 |
| InChI | InChI=1S/C12H13BrFNO/c13-10-6-8(3-4-11(10)14)12(16)9-2-1-5-15-7-9/h3-4,6,9,15H,1-2,5,7H2 |
| InChIKey | IENVMQKGOSNATH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |