C11H10BrF2NO — CID 106944034
(3-bromo-2,6-difluorophenyl)-pyrrolidin-3-ylmethanone (PubChem CID 106944034) has the molecular formula C11H10BrF2NO and a molecular weight of 290.11 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-pyrrolidin-3-ylmethanone.
| Compound Name | (3-bromo-2,6-difluorophenyl)-pyrrolidin-3-ylmethanone |
|---|---|
| PubChem CID | 106944034 |
| Molecular Formula | C11H10BrF2NO |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-pyrrolidin-3-ylmethanone |
| SMILES | O=C(c1c(F)ccc(Br)c1F)C1CCNC1 |
| InChI | InChI=1S/C11H10BrF2NO/c12-7-1-2-8(13)9(10(7)14)11(16)6-3-4-15-5-6/h1-2,6,15H,3-5H2 |
| InChIKey | HZKQWWNKUABWEQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|