C11H11Cl2NO — CID 116568315
(2,5-dichlorophenyl)-pyrrolidin-3-ylmethanone (PubChem CID 116568315) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-pyrrolidin-3-ylmethanone.
| Compound Name | (2,5-dichlorophenyl)-pyrrolidin-3-ylmethanone |
|---|---|
| PubChem CID | 116568315 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | (2,5-dichlorophenyl)-pyrrolidin-3-ylmethanone |
| SMILES | O=C(c1cc(Cl)ccc1Cl)C1CCNC1 |
| InChI | InChI=1S/C11H11Cl2NO/c12-8-1-2-10(13)9(5-8)11(15)7-3-4-14-6-7/h1-2,5,7,14H,3-4,6H2 |
| InChIKey | UCFGRYXENPXKGV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |