C12H13Cl2NO — CID 116592107
(2,5-dichlorophenyl)-(2-methylpyrrolidin-3-yl)methanone (PubChem CID 116592107) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(2-methylpyrrolidin-3-yl)methanone.
| Compound Name | (2,5-dichlorophenyl)-(2-methylpyrrolidin-3-yl)methanone |
|---|---|
| PubChem CID | 116592107 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (2,5-dichlorophenyl)-(2-methylpyrrolidin-3-yl)methanone |
| SMILES | CC1NCCC1C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H13Cl2NO/c1-7-9(4-5-15-7)12(16)10-6-8(13)2-3-11(10)14/h2-3,6-7,9,15H,4-5H2,1H3 |
| InChIKey | HATLRJVPIODYAV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |