C11H11Cl2NO2 — CID 116587500
(4-aminooxolan-3-yl)-(2,5-dichlorophenyl)methanone (PubChem CID 116587500) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is (4-aminooxolan-3-yl)-(2,5-dichlorophenyl)methanone.
| Compound Name | (4-aminooxolan-3-yl)-(2,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 116587500 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (4-aminooxolan-3-yl)-(2,5-dichlorophenyl)methanone |
| SMILES | NC1COCC1C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H11Cl2NO2/c12-6-1-2-9(13)7(3-6)11(15)8-4-16-5-10(8)14/h1-3,8,10H,4-5,14H2 |
| InChIKey | WQSYTPCKGKGBRW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |