C10H13NOS — CID 116592037
(2-methylpyrrolidin-3-yl)-thiophen-3-ylmethanone (PubChem CID 116592037) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is (2-methylpyrrolidin-3-yl)-thiophen-3-ylmethanone.
| Compound Name | (2-methylpyrrolidin-3-yl)-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 116592037 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2-methylpyrrolidin-3-yl)-thiophen-3-ylmethanone |
| SMILES | CC1NCCC1C(=O)c1ccsc1 |
| InChI | InChI=1S/C10H13NOS/c1-7-9(2-4-11-7)10(12)8-3-5-13-6-8/h3,5-7,9,11H,2,4H2,1H3 |
| InChIKey | NYHXDTKLNWHTJJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |