C13H18NOS+ — CID 5171625
(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-3-ylmethanone (PubChem CID 5171625) has the molecular formula C13H18NOS+ and a molecular weight of 236.36 g/mol. Its IUPAC name is (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-3-ylmethanone.
| Compound Name | (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 5171625 |
| Molecular Formula | C13H18NOS+ |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-3-ylmethanone |
| SMILES | C[N+]12CCC(CC1)C(C(=O)c1ccsc1)C2 |
| InChI | InChI=1S/C13H18NOS/c1-14-5-2-10(3-6-14)12(8-14)13(15)11-4-7-16-9-11/h4,7,9-10,12H,2-3,5-6,8H2,1H3/q+1 |
| InChIKey | LKRZDMLPPGYLEO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|