C15H20NO3S+ — CID 87463277
[1-(2-oxo-2-thiophen-3-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate (PubChem CID 87463277) has the molecular formula C15H20NO3S+ and a molecular weight of 294.40 g/mol. Its IUPAC name is [1-(2-oxo-2-thiophen-3-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate.
| Compound Name | [1-(2-oxo-2-thiophen-3-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate |
|---|---|
| PubChem CID | 87463277 |
| Molecular Formula | C15H20NO3S+ |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [1-(2-oxo-2-thiophen-3-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate |
| SMILES | CC(=O)OC1C[N+]2(CC(=O)c3ccsc3)CCC1CC2 |
| InChI | InChI=1S/C15H20NO3S/c1-11(17)19-15-9-16(5-2-12(15)3-6-16)8-14(18)13-4-7-20-10-13/h4,7,10,12,15H,2-3,5-6,8-9H2,1H3/q+1 |
| InChIKey | LVWHUKCZKFOIDH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|