C16H20NO3+ — CID 118460725
(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) formate (PubChem CID 118460725) has the molecular formula C16H20NO3+ and a molecular weight of 274.34 g/mol. Its IUPAC name is (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) formate.
| Compound Name | (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) formate |
|---|---|
| PubChem CID | 118460725 |
| Molecular Formula | C16H20NO3+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) formate |
| SMILES | O=COC1C[N+]2(CC(=O)c3ccccc3)CCC1CC2 |
| InChI | InChI=1S/C16H20NO3/c18-12-20-16-11-17(8-6-14(16)7-9-17)10-15(19)13-4-2-1-3-5-13/h1-5,12,14,16H,6-11H2/q+1 |
| InChIKey | XZHAUHHPEQRMHJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|