C26H29F3N2O5 — CID 46841667
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-amino-3-phenylpropanoate;2,2,2-trifluoroacetate (PubChem CID 46841667) has the molecular formula C26H29F3N2O5 and a molecular weight of 506.52 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-amino-3-phenylpropanoate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-amino-3-phenylpropanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 46841667 |
| Molecular Formula | C26H29F3N2O5 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-amino-3-phenylpropanoate;2,2,2-trifluoroacetate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O[C@H]1C[N+]2(CC(=O)c3ccccc3)CCC1CC2.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H29N2O3.C2HF3O2/c25-21(15-18-7-3-1-4-8-18)24(28)29-23-17-26(13-11-20(23)12-14-26)16-22(27)19-9-5-2-6-10-19;3-2(4,5)1(6)7/h1-10,20-21,23H,11-17,25H2;(H,6,7)/q+1;/p-1/t20?,21-,23-,26?;/m0./s1 |
| InChIKey | JPXXSGQCLQITDO-PHSYAEQHSA-M |
| XLogP | 1.89 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|