C30H30F3N3O5 — CID 87462035
[(3R)-1-(2-oxo-2-pyridin-4-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate (PubChem CID 87462035) has the molecular formula C30H30F3N3O5 and a molecular weight of 569.58 g/mol. Its IUPAC name is [(3R)-1-(2-oxo-2-pyridin-4-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-(2-oxo-2-pyridin-4-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87462035 |
| Molecular Formula | C30H30F3N3O5 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | [(3R)-1-(2-oxo-2-pyridin-4-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(Nc1ccccc1)c1ccccc1)C2)c1ccncc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H30N3O3.C2HF3O2/c32-25(21-11-15-29-16-12-21)19-31-17-13-22(14-18-31)26(20-31)34-28(33)27(23-7-3-1-4-8-23)30-24-9-5-2-6-10-24;3-2(4,5)1(6)7/h1-12,15-16,22,26-27,30H,13-14,17-20H2;(H,6,7)/q+1;/p-1/t22?,26-,27?,31?;/m0./s1 |
| InChIKey | KTFUTXCYEYYZMP-ZNCPWNLKSA-M |
| XLogP | 3.57 |
| TPSA | 108.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|