C27H33N2O3+ — CID 71616321
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-pyrrolidin-1-ylacetate (PubChem CID 71616321) has the molecular formula C27H33N2O3+ and a molecular weight of 433.57 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-pyrrolidin-1-ylacetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-pyrrolidin-1-ylacetate |
|---|---|
| PubChem CID | 71616321 |
| Molecular Formula | C27H33N2O3+ |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-pyrrolidin-1-ylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)[C@H](c1ccccc1)N1CCCC1)C2)c1ccccc1 |
| InChI | InChI=1S/C27H33N2O3/c30-24(21-9-3-1-4-10-21)19-29-17-13-22(14-18-29)25(20-29)32-27(31)26(28-15-7-8-16-28)23-11-5-2-6-12-23/h1-6,9-12,22,25-26H,7-8,13-20H2/q+1/t22?,25-,26-,29?/m0/s1 |
| InChIKey | SZEMAVWUEJNEBF-BQXZNZDXSA-N |
| XLogP | 3.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|