C34H33F3N2O6S — CID 87278807
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(1-benzothiophen-3-yl)-2-(3-methoxyanilino)acetate;2,2,2-trifluoroacetate (PubChem CID 87278807) has the molecular formula C34H33F3N2O6S and a molecular weight of 654.71 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(1-benzothiophen-3-yl)-2-(3-methoxyanilino)acetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(1-benzothiophen-3-yl)-2-(3-methoxyanilino)acetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87278807 |
| Molecular Formula | C34H33F3N2O6S |
| Molecular Weight | 654.71 g/mol |
| Exact Mass | 654.20 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(1-benzothiophen-3-yl)-2-(3-methoxyanilino)acetate;2,2,2-trifluoroacetate |
| SMILES | COc1cccc(NC(C(=O)O[C@H]2C[N+]3(CC(=O)c4ccccc4)CCC2CC3)c2csc3ccccc23)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C32H33N2O4S.C2HF3O2/c1-37-25-11-7-10-24(18-25)33-31(27-21-39-30-13-6-5-12-26(27)30)32(36)38-29-20-34(16-14-23(29)15-17-34)19-28(35)22-8-3-2-4-9-22;3-2(4,5)1(6)7/h2-13,18,21,23,29,31,33H,14-17,19-20H2,1H3;(H,6,7)/q+1;/p-1/t23?,29-,31?,34?;/m0./s1 |
| InChIKey | BVWPQXCXHYIXTG-VDYCQQLGSA-M |
| XLogP | 5.40 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|