C16H22BrNO3S — CID 17368348
ethyl 2-[3-(thiophene-3-carbonyl)-1-azoniabicyclo[2.2.2]octan-1-yl]acetate bromide (PubChem CID 17368348) has the molecular formula C16H22BrNO3S and a molecular weight of 388.33 g/mol. Its IUPAC name is ethyl 2-[3-(thiophene-3-carbonyl)-1-azoniabicyclo[2.2.2]octan-1-yl]acetate bromide.
| Compound Name | ethyl 2-[3-(thiophene-3-carbonyl)-1-azoniabicyclo[2.2.2]octan-1-yl]acetate bromide |
|---|---|
| PubChem CID | 17368348 |
| Molecular Formula | C16H22BrNO3S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | ethyl 2-[3-(thiophene-3-carbonyl)-1-azoniabicyclo[2.2.2]octan-1-yl]acetate bromide |
| SMILES | CCOC(=O)C[N+]12CCC(CC1)C(C(=O)c1ccsc1)C2.[Br-] |
| InChI | InChI=1S/C16H22NO3S.BrH/c1-2-20-15(18)10-17-6-3-12(4-7-17)14(9-17)16(19)13-5-8-21-11-13;/h5,8,11-12,14H,2-4,6-7,9-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | REAQXPHREJITHW-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|