C13H18ClNOS — CID 163331429
(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-3-ylmethanone chloride (PubChem CID 163331429) has the molecular formula C13H18ClNOS and a molecular weight of 271.81 g/mol. Its IUPAC name is (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-3-ylmethanone chloride.
| Compound Name | (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-3-ylmethanone chloride |
|---|---|
| PubChem CID | 163331429 |
| Molecular Formula | C13H18ClNOS |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-3-ylmethanone chloride |
| SMILES | C[N+]12CCC(CC1)C(C(=O)c1ccsc1)C2.[Cl-] |
| InChI | InChI=1S/C13H18NOS.ClH/c1-14-5-2-10(3-6-14)12(8-14)13(15)11-4-7-16-9-11;/h4,7,9-10,12H,2-3,5-6,8H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZZXAKXPSTLXPIZ-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|