C14H15BrF2O — CID 106941683
(3-bromo-2,6-difluorophenyl)-(3-methylcyclohexyl)methanone (PubChem CID 106941683) has the molecular formula C14H15BrF2O and a molecular weight of 317.17 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(3-methylcyclohexyl)methanone.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(3-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 106941683 |
| Molecular Formula | C14H15BrF2O |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(3-methylcyclohexyl)methanone |
| SMILES | CC1CCCC(C(=O)c2c(F)ccc(Br)c2F)C1 |
| InChI | InChI=1S/C14H15BrF2O/c1-8-3-2-4-9(7-8)14(18)12-11(16)6-5-10(15)13(12)17/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | JBOXJAMSDKZQLN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|