C13H14BrF2NO — CID 106944074
azepan-2-yl-(3-bromo-2,6-difluorophenyl)methanone (PubChem CID 106944074) has the molecular formula C13H14BrF2NO and a molecular weight of 318.16 g/mol. Its IUPAC name is azepan-2-yl-(3-bromo-2,6-difluorophenyl)methanone.
| Compound Name | azepan-2-yl-(3-bromo-2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 106944074 |
| Molecular Formula | C13H14BrF2NO |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | azepan-2-yl-(3-bromo-2,6-difluorophenyl)methanone |
| SMILES | O=C(c1c(F)ccc(Br)c1F)C1CCCCCN1 |
| InChI | InChI=1S/C13H14BrF2NO/c14-8-5-6-9(15)11(12(8)16)13(18)10-4-2-1-3-7-17-10/h5-6,10,17H,1-4,7H2 |
| InChIKey | DFQUCNGCBWEWFV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|