C11H9BrF2OS2 — CID 106941806
(3-bromo-2,6-difluorophenyl)-(1,4-dithian-2-yl)methanone (PubChem CID 106941806) has the molecular formula C11H9BrF2OS2 and a molecular weight of 339.23 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(1,4-dithian-2-yl)methanone.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 106941806 |
| Molecular Formula | C11H9BrF2OS2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 337.92 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(1,4-dithian-2-yl)methanone |
| SMILES | O=C(c1c(F)ccc(Br)c1F)C1CSCCS1 |
| InChI | InChI=1S/C11H9BrF2OS2/c12-6-1-2-7(13)9(10(6)14)11(15)8-5-16-3-4-17-8/h1-2,8H,3-5H2 |
| InChIKey | SSRDQQJJJGFTRO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|