C12H14BrF2NS2 — CID 114165712
N-[(3-bromo-2,6-difluorophenyl)methyl]-1-(1,4-dithian-2-yl)methanamine (PubChem CID 114165712) has the molecular formula C12H14BrF2NS2 and a molecular weight of 354.29 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-1-(1,4-dithian-2-yl)methanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-1-(1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 114165712 |
| Molecular Formula | C12H14BrF2NS2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-1-(1,4-dithian-2-yl)methanamine |
| SMILES | Fc1ccc(Br)c(F)c1CNCC1CSCCS1 |
| InChI | InChI=1S/C12H14BrF2NS2/c13-10-1-2-11(14)9(12(10)15)6-16-5-8-7-17-3-4-18-8/h1-2,8,16H,3-7H2 |
| InChIKey | BRJOJCHRDZCEPE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|