C12H15F2NOS2 — CID 113256943
4-[(1,4-dithian-2-ylmethylamino)methyl]-2,6-difluorophenol (PubChem CID 113256943) has the molecular formula C12H15F2NOS2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-[(1,4-dithian-2-ylmethylamino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(1,4-dithian-2-ylmethylamino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 113256943 |
| Molecular Formula | C12H15F2NOS2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-[(1,4-dithian-2-ylmethylamino)methyl]-2,6-difluorophenol |
| SMILES | Oc1c(F)cc(CNCC2CSCCS2)cc1F |
| InChI | InChI=1S/C12H15F2NOS2/c13-10-3-8(4-11(14)12(10)16)5-15-6-9-7-17-1-2-18-9/h3-4,9,15-16H,1-2,5-7H2 |
| InChIKey | MTTCXEPDIJLPTR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |