C13H18N2OS2 — CID 115696182
3-[(1,4-dithian-2-ylmethylamino)methyl]benzamide (PubChem CID 115696182) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-[(1,4-dithian-2-ylmethylamino)methyl]benzamide.
| Compound Name | 3-[(1,4-dithian-2-ylmethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 115696182 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-[(1,4-dithian-2-ylmethylamino)methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNCC2CSCCS2)c1 |
| InChI | InChI=1S/C13H18N2OS2/c14-13(16)11-3-1-2-10(6-11)7-15-8-12-9-17-4-5-18-12/h1-3,6,12,15H,4-5,7-9H2,(H2,14,16) |
| InChIKey | APUBTPWRTCILRK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |